C17H22F3NO5 — CID 71879831
ethyl 2-[2-methoxyethyl-[3-[4-(trifluoromethoxy)phenyl]propanoyl]amino]acetate (PubChem CID 71879831) has the molecular formula C17H22F3NO5 and a molecular weight of 377.36 g/mol. Its IUPAC name is ethyl 2-[2-methoxyethyl-[3-[4-(trifluoromethoxy)phenyl]propanoyl]amino]acetate.
| Compound Name | ethyl 2-[2-methoxyethyl-[3-[4-(trifluoromethoxy)phenyl]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 71879831 |
| Molecular Formula | C17H22F3NO5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | ethyl 2-[2-methoxyethyl-[3-[4-(trifluoromethoxy)phenyl]propanoyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)CCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO5/c1-3-25-16(23)12-21(10-11-24-2)15(22)9-6-13-4-7-14(8-5-13)26-17(18,19)20/h4-5,7-8H,3,6,9-12H2,1-2H3 |
| InChIKey | QLPJGAQYBQVOHC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |