C21H27F3N2O4 — CID 135122848
5-(2,2-diethoxyethoxy)-N,4,6-trimethyl-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine (PubChem CID 135122848) has the molecular formula C21H27F3N2O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is 5-(2,2-diethoxyethoxy)-N,4,6-trimethyl-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine.
| Compound Name | 5-(2,2-diethoxyethoxy)-N,4,6-trimethyl-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 135122848 |
| Molecular Formula | C21H27F3N2O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-(2,2-diethoxyethoxy)-N,4,6-trimethyl-N-[4-(trifluoromethoxy)phenyl]pyridin-2-amine |
| SMILES | CCOC(COc1c(C)cc(N(C)c2ccc(OC(F)(F)F)cc2)nc1C)OCC |
| InChI | InChI=1S/C21H27F3N2O4/c1-6-27-19(28-7-2)13-29-20-14(3)12-18(25-15(20)4)26(5)16-8-10-17(11-9-16)30-21(22,23)24/h8-12,19H,6-7,13H2,1-5H3 |
| InChIKey | XGJLDMDMSYSFND-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|