C27H18ClF6N5OS — CID 130394378
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-[3-[4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea (PubChem CID 130394378) has the molecular formula C27H18ClF6N5OS and a molecular weight of 609.98 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-[3-[4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-[3-[4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 130394378 |
| Molecular Formula | C27H18ClF6N5OS |
| Molecular Weight | 609.98 g/mol |
| Exact Mass | 609.08 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-[3-[4-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]benzo[e]benzimidazol-7-yl]methylideneamino]thiourea |
| SMILES | FC(F)(F)OC1=CCC(n2cnc3c4ccc(/C=N/NC(=S)Nc5cc(C(F)(F)F)ccc5Cl)cc4ccc32)C=C1 |
| InChI | InChI=1S/C27H18ClF6N5OS/c28-21-9-3-17(26(29,30)31)12-22(21)37-25(41)38-36-13-15-1-8-20-16(11-15)2-10-23-24(20)35-14-39(23)18-4-6-19(7-5-18)40-27(32,33)34/h1-4,6-14,18H,5H2,(H2,37,38,41)/b36-13+ |
| InChIKey | KGMVZLWMOAIXEF-FIFHTESVSA-N |
| XLogP | 8.10 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.98 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|