C25H21ClF3N3O4S — CID 6904471
methyl 4-[[4-[(E)-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoate (PubChem CID 6904471) has the molecular formula C25H21ClF3N3O4S and a molecular weight of 551.97 g/mol. Its IUPAC name is methyl 4-[[4-[(E)-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-[(E)-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 6904471 |
| Molecular Formula | C25H21ClF3N3O4S |
| Molecular Weight | 551.97 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | methyl 4-[[4-[(E)-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]-2-methoxyphenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(/C=N/NC(=S)Nc3cc(C(F)(F)F)ccc3Cl)cc2OC)cc1 |
| InChI | InChI=1S/C25H21ClF3N3O4S/c1-34-22-11-16(5-10-21(22)36-14-15-3-6-17(7-4-15)23(33)35-2)13-30-32-24(37)31-20-12-18(25(27,28)29)8-9-19(20)26/h3-13H,14H2,1-2H3,(H2,31,32,37)/b30-13+ |
| InChIKey | RILJAUGMQCLIER-VVEOGCPPSA-N |
| XLogP | 6.05 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.97 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|