C23H19ClF3N3O2S — CID 6904459
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]thiourea (PubChem CID 6904459) has the molecular formula C23H19ClF3N3O2S and a molecular weight of 493.94 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6904459 |
| Molecular Formula | C23H19ClF3N3O2S |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccc(/C=N/NC(=S)Nc2cc(C(F)(F)F)ccc2Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H19ClF3N3O2S/c1-31-20-10-7-16(11-21(20)32-14-15-5-3-2-4-6-15)13-28-30-22(33)29-19-12-17(23(25,26)27)8-9-18(19)24/h2-13H,14H2,1H3,(H2,29,30,33)/b28-13+ |
| InChIKey | GKGLMBVHUSSJEE-XODNFHPESA-N |
| XLogP | 6.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|