C26H23ClF3N3O4 — CID 4053036
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 4053036) has the molecular formula C26H23ClF3N3O4 and a molecular weight of 533.93 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 4053036 |
| Molecular Formula | C26H23ClF3N3O4 |
| Molecular Weight | 533.93 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C26H23ClF3N3O4/c1-3-36-23-12-17(7-10-22(23)37-15-18-6-4-5-16(2)11-18)14-31-33-25(35)24(34)32-21-13-19(26(28,29)30)8-9-20(21)27/h4-14H,3,15H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | KTOQGLLQQDMACS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.93 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|