C27H29N3O6 — CID 19661521
N-(2,5-dimethoxyphenyl)-N'-[(E)-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 19661521) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-N'-[(E)-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-N'-[(E)-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 19661521 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-N'-[(E)-[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(=O)Nc2cc(OC)ccc2OC)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C27H29N3O6/c1-5-35-25-14-19(9-11-24(25)36-17-20-8-6-7-18(2)13-20)16-28-30-27(32)26(31)29-22-15-21(33-3)10-12-23(22)34-4/h6-16H,5,17H2,1-4H3,(H,29,31)(H,30,32)/b28-16+ |
| InChIKey | UUFQUYBREKYJRX-LQKURTRISA-N |
| XLogP | 4.08 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|