C24H23N3O4 — CID 5077102
N-(4-methoxyphenyl)-N'-[[4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 5077102) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N'-[[4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(4-methoxyphenyl)-N'-[[4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 5077102 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-(4-methoxyphenyl)-N'-[[4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NN=Cc2ccc(OCc3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O4/c1-17-4-3-5-19(14-17)16-31-22-10-6-18(7-11-22)15-25-27-24(29)23(28)26-20-8-12-21(30-2)13-9-20/h3-15H,16H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | FNEBCRMKQLEAHK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|