C17H15ClF3N3O2S — CID 18281660
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-(2,3-dimethoxyphenyl)methylideneamino]thiourea (PubChem CID 18281660) has the molecular formula C17H15ClF3N3O2S and a molecular weight of 417.84 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-(2,3-dimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-(2,3-dimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 18281660 |
| Molecular Formula | C17H15ClF3N3O2S |
| Molecular Weight | 417.84 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(E)-(2,3-dimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cccc(/C=N/NC(=S)Nc2cc(C(F)(F)F)ccc2Cl)c1OC |
| InChI | InChI=1S/C17H15ClF3N3O2S/c1-25-14-5-3-4-10(15(14)26-2)9-22-24-16(27)23-13-8-11(17(19,20)21)6-7-12(13)18/h3-9H,1-2H3,(H2,23,24,27)/b22-9+ |
| InChIKey | LDAIKNPYPOFNRD-LSFURLLWSA-N |
| XLogP | 4.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|