C17H15ClF3N3S — CID 4134519
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2-phenylpropylideneamino)thiourea (PubChem CID 4134519) has the molecular formula C17H15ClF3N3S and a molecular weight of 385.84 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2-phenylpropylideneamino)thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2-phenylpropylideneamino)thiourea |
|---|---|
| PubChem CID | 4134519 |
| Molecular Formula | C17H15ClF3N3S |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2-phenylpropylideneamino)thiourea |
| SMILES | CC(C=NNC(=S)Nc1cc(C(F)(F)F)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H15ClF3N3S/c1-11(12-5-3-2-4-6-12)10-22-24-16(25)23-15-9-13(17(19,20)21)7-8-14(15)18/h2-11H,1H3,(H2,23,24,25) |
| InChIKey | NMYLZOHYVZJUPI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|