C21H14ClF3N4O2S — CID 2424515
[4-[[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenyl] pyridine-3-carboxylate (PubChem CID 2424515) has the molecular formula C21H14ClF3N4O2S and a molecular weight of 478.88 g/mol. Its IUPAC name is [4-[[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenyl] pyridine-3-carboxylate.
| Compound Name | [4-[[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2424515 |
| Molecular Formula | C21H14ClF3N4O2S |
| Molecular Weight | 478.88 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | [4-[[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioylhydrazinylidene]methyl]phenyl] pyridine-3-carboxylate |
| SMILES | O=C(Oc1ccc(C=NNC(=S)Nc2cc(C(F)(F)F)ccc2Cl)cc1)c1cccnc1 |
| InChI | InChI=1S/C21H14ClF3N4O2S/c22-17-8-5-15(21(23,24)25)10-18(17)28-20(32)29-27-11-13-3-6-16(7-4-13)31-19(30)14-2-1-9-26-12-14/h1-12H,(H2,28,29,32) |
| InChIKey | MDDZKZVZTNJLTQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.88 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|