C24H21N3O2 — CID 155149850
5-[(E)-[(2,6-dimethylphenyl)hydrazinylidene]methyl]-2-(4-methylphenyl)isoindole-1,3-dione (PubChem CID 155149850) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 5-[(E)-[(2,6-dimethylphenyl)hydrazinylidene]methyl]-2-(4-methylphenyl)isoindole-1,3-dione.
| Compound Name | 5-[(E)-[(2,6-dimethylphenyl)hydrazinylidene]methyl]-2-(4-methylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155149850 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 5-[(E)-[(2,6-dimethylphenyl)hydrazinylidene]methyl]-2-(4-methylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3ccc(/C=N/Nc4c(C)cccc4C)cc3C2=O)cc1 |
| InChI | InChI=1S/C24H21N3O2/c1-15-7-10-19(11-8-15)27-23(28)20-12-9-18(13-21(20)24(27)29)14-25-26-22-16(2)5-4-6-17(22)3/h4-14,26H,1-3H3/b25-14+ |
| InChIKey | VDRCUXBQWCZHHB-AFUMVMLFSA-N |
| XLogP | 4.86 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|