C27H19Cl2F3N4O2S — CID 172944913
1-(2,4-dichloro-6-methylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydrobenzo[g][2,1]benzoxazol-7-yl]methylideneamino]thiourea (PubChem CID 172944913) has the molecular formula C27H19Cl2F3N4O2S and a molecular weight of 591.44 g/mol. Its IUPAC name is 1-(2,4-dichloro-6-methylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydrobenzo[g][2,1]benzoxazol-7-yl]methylideneamino]thiourea.
| Compound Name | 1-(2,4-dichloro-6-methylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydrobenzo[g][2,1]benzoxazol-7-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 172944913 |
| Molecular Formula | C27H19Cl2F3N4O2S |
| Molecular Weight | 591.44 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | 1-(2,4-dichloro-6-methylphenyl)-3-[(E)-[3-[4-(trifluoromethoxy)phenyl]-4,5-dihydrobenzo[g][2,1]benzoxazol-7-yl]methylideneamino]thiourea |
| SMILES | Cc1cc(Cl)cc(Cl)c1NC(=S)N/N=C/c1ccc2c(c1)CCc1c-2noc1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H19Cl2F3N4O2S/c1-14-10-18(28)12-22(29)23(14)34-26(39)35-33-13-15-2-8-20-17(11-15)5-9-21-24(20)36-38-25(21)16-3-6-19(7-4-16)37-27(30,31)32/h2-4,6-8,10-13H,5,9H2,1H3,(H2,34,35,39)/b33-13+ |
| InChIKey | UMBCCZMKKUVQJU-IIHBXENTSA-N |
| XLogP | 7.94 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.44 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|