C24H21N3S — CID 4561308
1-(anthracen-9-ylmethylideneamino)-3-(2,4-dimethylphenyl)thiourea (PubChem CID 4561308) has the molecular formula C24H21N3S and a molecular weight of 383.52 g/mol. Its IUPAC name is 1-(anthracen-9-ylmethylideneamino)-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-(anthracen-9-ylmethylideneamino)-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 4561308 |
| Molecular Formula | C24H21N3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-(anthracen-9-ylmethylideneamino)-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NN=Cc2c3ccccc3cc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C24H21N3S/c1-16-11-12-23(17(2)13-16)26-24(28)27-25-15-22-20-9-5-3-7-18(20)14-19-8-4-6-10-21(19)22/h3-15H,1-2H3,(H2,26,27,28) |
| InChIKey | UEJQYLKKOWPEPJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|