C19H17N3S — CID 6178455
1-[(Z)-anthracen-9-ylmethylideneamino]-3-prop-2-enylthiourea (PubChem CID 6178455) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-[(Z)-anthracen-9-ylmethylideneamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[(Z)-anthracen-9-ylmethylideneamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 6178455 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[(Z)-anthracen-9-ylmethylideneamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N/N=C\c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C19H17N3S/c1-2-11-20-19(23)22-21-13-18-16-9-5-3-7-14(16)12-15-8-4-6-10-17(15)18/h2-10,12-13H,1,11H2,(H2,20,22,23)/b21-13- |
| InChIKey | DHAPTCXTGZEHLT-BKUYFWCQSA-N |
| XLogP | 3.98 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|