C18H19F2N3O2S — CID 18226944
1-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 18226944) has the molecular formula C18H19F2N3O2S and a molecular weight of 379.43 g/mol. Its IUPAC name is 1-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 18226944 |
| Molecular Formula | C18H19F2N3O2S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | COc1cc(/C=N/NC(=S)Nc2ccc(C)cc2C)ccc1OC(F)F |
| InChI | InChI=1S/C18H19F2N3O2S/c1-11-4-6-14(12(2)8-11)22-18(26)23-21-10-13-5-7-15(25-17(19)20)16(9-13)24-3/h4-10,17H,1-3H3,(H2,22,23,26)/b21-10+ |
| InChIKey | VQNMCPOVSFRIKH-UFFVCSGVSA-N |
| XLogP | 4.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|