C16H15N2O3- — CID 135692398
4-[(E)-[(4-carboxyphenyl)hydrazinylidene]methyl]-2,6-dimethylphenolate (PubChem CID 135692398) has the molecular formula C16H15N2O3- and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-[(E)-[(4-carboxyphenyl)hydrazinylidene]methyl]-2,6-dimethylphenolate.
| Compound Name | 4-[(E)-[(4-carboxyphenyl)hydrazinylidene]methyl]-2,6-dimethylphenolate |
|---|---|
| PubChem CID | 135692398 |
| Molecular Formula | C16H15N2O3- |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-[(E)-[(4-carboxyphenyl)hydrazinylidene]methyl]-2,6-dimethylphenolate |
| SMILES | Cc1cc(/C=N/Nc2ccc(C(=O)O)cc2)cc(C)c1[O-] |
| InChI | InChI=1S/C16H16N2O3/c1-10-7-12(8-11(2)15(10)19)9-17-18-14-5-3-13(4-6-14)16(20)21/h3-9,18-19H,1-2H3,(H,20,21)/p-1/b17-9+ |
| InChIKey | FJGYFZJSKREZEB-RQZCQDPDSA-M |
| XLogP | 2.52 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|