C17H18N2O2S — CID 110841197
4-[2-[(4-propan-2-ylsulfanylphenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 110841197) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-[2-[(4-propan-2-ylsulfanylphenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[(4-propan-2-ylsulfanylphenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 110841197 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-[2-[(4-propan-2-ylsulfanylphenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | CC(C)Sc1ccc(C=NNc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-12(2)22-16-9-3-13(4-10-16)11-18-19-15-7-5-14(6-8-15)17(20)21/h3-12,19H,1-2H3,(H,20,21) |
| InChIKey | XSPHYHQUNVKMEI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|