C15H13ClN2O2 — CID 59021908
4-[(2E)-2-[(3-chloro-5-methylphenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 59021908) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 4-[(2E)-2-[(3-chloro-5-methylphenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[(2E)-2-[(3-chloro-5-methylphenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 59021908 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-[(2E)-2-[(3-chloro-5-methylphenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | Cc1cc(Cl)cc(/C=N/Nc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C15H13ClN2O2/c1-10-6-11(8-13(16)7-10)9-17-18-14-4-2-12(3-5-14)15(19)20/h2-9,18H,1H3,(H,19,20)/b17-9+ |
| InChIKey | KMAUORVTDLVJAZ-RQZCQDPDSA-N |
| XLogP | 3.79 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|