C11H9F7N2S — CID 126047088
1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]propan-1-amine (PubChem CID 126047088) has the molecular formula C11H9F7N2S and a molecular weight of 334.26 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126047088 |
| Molecular Formula | C11H9F7N2S |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-(4-methylsulfanylphenyl)methylideneamino]propan-1-amine |
| SMILES | CSc1ccc(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F7N2S/c1-21-8-4-2-7(3-5-8)6-19-20-11(17,18)9(12,13)10(14,15)16/h2-6,20H,1H3/b19-6+ |
| InChIKey | TYEZWFHZHNXZCX-KPSZGOFPSA-N |
| XLogP | 4.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|