C8H5F7N2O — CID 126046698
1,1,2,2,3,3,3-heptafluoro-N-[(E)-furan-2-ylmethylideneamino]propan-1-amine (PubChem CID 126046698) has the molecular formula C8H5F7N2O and a molecular weight of 278.13 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(E)-furan-2-ylmethylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-furan-2-ylmethylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126046698 |
| Molecular Formula | C8H5F7N2O |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(E)-furan-2-ylmethylideneamino]propan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N/N=C/c1ccco1 |
| InChI | InChI=1S/C8H5F7N2O/c9-6(10,7(11,12)13)8(14,15)17-16-4-5-2-1-3-18-5/h1-4,17H/b16-4+ |
| InChIKey | HPZADPHACFZNQA-AYSLTRBKSA-N |
| XLogP | 2.99 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|