C18H14ClF7N2O2 — CID 126035891
N-[(Z)-[2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126035891) has the molecular formula C18H14ClF7N2O2 and a molecular weight of 458.76 g/mol. Its IUPAC name is N-[(Z)-[2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(Z)-[2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126035891 |
| Molecular Formula | C18H14ClF7N2O2 |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N-[(Z)-[2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | COc1cccc(/C=N\NC(F)(F)C(F)(F)C(F)(F)F)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H14ClF7N2O2/c1-29-14-7-3-5-12(15(14)30-10-11-4-2-6-13(19)8-11)9-27-28-18(25,26)16(20,21)17(22,23)24/h2-9,28H,10H2,1H3/b27-9- |
| InChIKey | ABQUOKQZHYOXNN-WPDGFUPNSA-N |
| XLogP | 5.64 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|