C19H14F7N3O2 — CID 126056339
4-[[2-[(Z)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126056339) has the molecular formula C19H14F7N3O2 and a molecular weight of 449.33 g/mol. Its IUPAC name is 4-[[2-[(Z)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 4-[[2-[(Z)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126056339 |
| Molecular Formula | C19H14F7N3O2 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 4-[[2-[(Z)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cccc(/C=N\NC(F)(F)C(F)(F)C(F)(F)F)c1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H14F7N3O2/c1-30-15-4-2-3-14(10-28-29-19(25,26)17(20,21)18(22,23)24)16(15)31-11-13-7-5-12(9-27)6-8-13/h2-8,10,29H,11H2,1H3/b28-10- |
| InChIKey | RKMWGIGZJFSNCV-LGUSAWBASA-N |
| XLogP | 4.86 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|