C18H10Cl2F7N3O — CID 126052946
4-[[2,4-dichloro-6-[(Z)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]methyl]benzonitrile (PubChem CID 126052946) has the molecular formula C18H10Cl2F7N3O and a molecular weight of 488.19 g/mol. Its IUPAC name is 4-[[2,4-dichloro-6-[(Z)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 4-[[2,4-dichloro-6-[(Z)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126052946 |
| Molecular Formula | C18H10Cl2F7N3O |
| Molecular Weight | 488.19 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 4-[[2,4-dichloro-6-[(Z)-(1,1,2,2,3,3,3-heptafluoropropylhydrazinylidene)methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccc(COc2c(Cl)cc(Cl)cc2/C=N\NC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H10Cl2F7N3O/c19-13-5-12(8-29-30-18(26,27)16(21,22)17(23,24)25)15(14(20)6-13)31-9-11-3-1-10(7-28)2-4-11/h1-6,8,30H,9H2/b29-8- |
| InChIKey | RKXHJAQLKYOOAQ-HYYKAVFWSA-N |
| XLogP | 6.16 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.19 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|