4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid

C15H9Cl2NO3 — CID 3924196

IUPAC4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid
SMILESN#Cc1cc(Cl)c(OCc2ccc(C(=O)O)cc2)c(Cl)c1
InChIInChI=1S/C15H9Cl2NO3/c16-12-5-10(7-18)6-13(17)14(12)21-8-9-1-3-11(4-2-9)15(19)20/h1-6H,8H2,(H,19,20)
InChIKeyNOKAZIAEWVCYQJ-UHFFFAOYSA-N
MW322.15 g/mol
LogP4.14
Rot. Bonds4

About 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid

4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid (PubChem CID 3924196) has the molecular formula C15H9Cl2NO3 and a molecular weight of 322.15 g/mol. Its IUPAC name is 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid.

Molecular Properties

Compound Name4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid
PubChem CID3924196
Molecular FormulaC15H9Cl2NO3
Molecular Weight322.15 g/mol
Exact Mass321.00
IUPAC Name4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid
SMILESN#Cc1cc(Cl)c(OCc2ccc(C(=O)O)cc2)c(Cl)c1
InChIInChI=1S/C15H9Cl2NO3/c16-12-5-10(7-18)6-13(17)14(12)21-8-9-1-3-11(4-2-9)15(19)20/h1-6H,8H2,(H,19,20)
InChIKeyNOKAZIAEWVCYQJ-UHFFFAOYSA-N
XLogP4.14
TPSA70.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.15
LogP ≤ 54.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid?
The IUPAC name of 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid (CID 3924196) is 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid.
What is the SMILES notation for 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid?
The canonical SMILES for 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid is N#Cc1cc(Cl)c(OCc2ccc(C(=O)O)cc2)c(Cl)c1.
What is the InChIKey of 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid?
The InChIKey is NOKAZIAEWVCYQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2NO3/c16-12-5-10(7-18)6-13(17)14(12)21-8-9-1-3-11(4-2-9)15(19)20/h1-6H,8H2,(H,19,20).
What are the key properties of 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid?
4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid has a molecular weight of 322.15 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dichloro-4-cyanophenoxy)methyl]benzoic acid is sourced from PubChem (CID 3924196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).