C14H8BrCl2NO — CID 91683303
4-[(3-bromophenyl)methoxy]-3,5-dichlorobenzonitrile (PubChem CID 91683303) has the molecular formula C14H8BrCl2NO and a molecular weight of 357.03 g/mol. Its IUPAC name is 4-[(3-bromophenyl)methoxy]-3,5-dichlorobenzonitrile.
| Compound Name | 4-[(3-bromophenyl)methoxy]-3,5-dichlorobenzonitrile |
|---|---|
| PubChem CID | 91683303 |
| Molecular Formula | C14H8BrCl2NO |
| Molecular Weight | 357.03 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | 4-[(3-bromophenyl)methoxy]-3,5-dichlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)c(OCc2cccc(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C14H8BrCl2NO/c15-11-3-1-2-9(4-11)8-19-14-12(16)5-10(7-18)6-13(14)17/h1-6H,8H2 |
| InChIKey | LSWFXFOVIFSNAM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |