C16H14Br2N2O — CID 107739569
3-[[4-(2-aminoethyl)-2,6-dibromophenoxy]methyl]benzonitrile (PubChem CID 107739569) has the molecular formula C16H14Br2N2O and a molecular weight of 410.11 g/mol. Its IUPAC name is 3-[[4-(2-aminoethyl)-2,6-dibromophenoxy]methyl]benzonitrile.
| Compound Name | 3-[[4-(2-aminoethyl)-2,6-dibromophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 107739569 |
| Molecular Formula | C16H14Br2N2O |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | 3-[[4-(2-aminoethyl)-2,6-dibromophenoxy]methyl]benzonitrile |
| SMILES | N#Cc1cccc(COc2c(Br)cc(CCN)cc2Br)c1 |
| InChI | InChI=1S/C16H14Br2N2O/c17-14-7-11(4-5-19)8-15(18)16(14)21-10-13-3-1-2-12(6-13)9-20/h1-3,6-8H,4-5,10,19H2 |
| InChIKey | UZSVCSUIRDPXHP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |