C20H15BrF7N3 — CID 126043612
N-[(E)-[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126043612) has the molecular formula C20H15BrF7N3 and a molecular weight of 510.25 g/mol. Its IUPAC name is N-[(E)-[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126043612 |
| Molecular Formula | C20H15BrF7N3 |
| Molecular Weight | 510.25 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | N-[(E)-[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | Cc1c(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)c2ccccc2n1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H15BrF7N3/c1-12-16(10-29-30-20(27,28)18(22,23)19(24,25)26)15-4-2-3-5-17(15)31(12)11-13-6-8-14(21)9-7-13/h2-10,30H,11H2,1H3/b29-10+ |
| InChIKey | SKKANLSRDMYIOP-VYVUJPJFSA-N |
| XLogP | 6.47 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.25 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|