C21H16Cl2F7N3 — CID 126048849
N-[(E)-[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126048849) has the molecular formula C21H16Cl2F7N3 and a molecular weight of 514.27 g/mol. Its IUPAC name is N-[(E)-[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(E)-[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126048849 |
| Molecular Formula | C21H16Cl2F7N3 |
| Molecular Weight | 514.27 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | N-[(E)-[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | Cc1ccc2c(c1)c(/C=N/NC(F)(F)C(F)(F)C(F)(F)F)c(C)n2Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2F7N3/c1-11-3-6-18-14(7-11)15(9-31-32-21(29,30)19(24,25)20(26,27)28)12(2)33(18)10-13-4-5-16(22)17(23)8-13/h3-9,32H,10H2,1-2H3/b31-9+ |
| InChIKey | KSCZRSRNZKQHKN-LODFRUGASA-N |
| XLogP | 7.33 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.27 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|