C35H25Cl2N3O2 — CID 124533632
(15S,19S)-17-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124533632) has the molecular formula C35H25Cl2N3O2 and a molecular weight of 590.51 g/mol. Its IUPAC name is (15S,19S)-17-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-17-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124533632 |
| Molecular Formula | C35H25Cl2N3O2 |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | (15S,19S)-17-[(Z)-[1-[(3,4-dichlorophenyl)methyl]-2-methylindol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | Cc1c(/C=N\N2C(=O)[C@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)c2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C35H25Cl2N3O2/c1-19-26(21-8-6-7-13-29(21)39(19)18-20-14-15-27(36)28(37)16-20)17-38-40-34(41)32-30-22-9-2-3-10-23(22)31(33(32)35(40)42)25-12-5-4-11-24(25)30/h2-17,30-33H,18H2,1H3/b38-17-/t30?,31?,32-,33-/m0/s1 |
| InChIKey | RYWMBVPCLQJMJL-HUQVUZATSA-N |
| XLogP | 7.53 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|