C28H20BrCl2N3O3 — CID 3927599
1-(4-bromophenyl)-5-[[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 3927599) has the molecular formula C28H20BrCl2N3O3 and a molecular weight of 597.30 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-[[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-bromophenyl)-5-[[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3927599 |
| Molecular Formula | C28H20BrCl2N3O3 |
| Molecular Weight | 597.30 g/mol |
| Exact Mass | 595.01 |
| IUPAC Name | 1-(4-bromophenyl)-5-[[1-[(3,4-dichlorophenyl)methyl]-2,5-dimethylindol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc2c(c1)c(C=C1C(=O)NC(=O)N(c3ccc(Br)cc3)C1=O)c(C)n2Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H20BrCl2N3O3/c1-15-3-10-25-21(11-15)20(16(2)33(25)14-17-4-9-23(30)24(31)12-17)13-22-26(35)32-28(37)34(27(22)36)19-7-5-18(29)6-8-19/h3-13H,14H2,1-2H3,(H,32,35,37) |
| InChIKey | FSEAGOLTXCZWDK-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.30 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|