C26H19BrClN3O2 — CID 126179444
(5E)-5-[[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione (PubChem CID 126179444) has the molecular formula C26H19BrClN3O2 and a molecular weight of 520.81 g/mol. Its IUPAC name is (5E)-5-[[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126179444 |
| Molecular Formula | C26H19BrClN3O2 |
| Molecular Weight | 520.81 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | (5E)-5-[[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione |
| SMILES | Cc1c(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)c2ccccc2n1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H19BrClN3O2/c1-16-22(14-23-25(32)31(26(33)29-23)20-12-10-19(28)11-13-20)21-4-2-3-5-24(21)30(16)15-17-6-8-18(27)9-7-17/h2-14H,15H2,1H3,(H,29,33)/b23-14+ |
| InChIKey | LMHVGKSWJSOGHC-OEAKJJBVSA-N |
| XLogP | 6.51 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.81 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|