C16H12F7N3 — CID 126046264
1,1,2,2,3,3,3-heptafluoro-N-[(Z)-(2-methyl-1-prop-2-ynylindol-3-yl)methylideneamino]propan-1-amine (PubChem CID 126046264) has the molecular formula C16H12F7N3 and a molecular weight of 379.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoro-N-[(Z)-(2-methyl-1-prop-2-ynylindol-3-yl)methylideneamino]propan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptafluoro-N-[(Z)-(2-methyl-1-prop-2-ynylindol-3-yl)methylideneamino]propan-1-amine |
|---|---|
| PubChem CID | 126046264 |
| Molecular Formula | C16H12F7N3 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoro-N-[(Z)-(2-methyl-1-prop-2-ynylindol-3-yl)methylideneamino]propan-1-amine |
| SMILES | C#CCn1c(C)c(/C=N\NC(F)(F)C(F)(F)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C16H12F7N3/c1-3-8-26-10(2)12(11-6-4-5-7-13(11)26)9-24-25-16(22,23)14(17,18)15(19,20)21/h1,4-7,9,25H,8H2,2H3/b24-9- |
| InChIKey | SHARNDKAGNKWTR-OPVMPGTRSA-N |
| XLogP | 4.30 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|