C19H21N3O3 — CID 5427695
2-(2-methyl-1,3-dioxolan-2-yl)-N-[(Z)-(2-methyl-1-prop-2-ynylindol-3-yl)methylideneamino]acetamide (PubChem CID 5427695) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dioxolan-2-yl)-N-[(Z)-(2-methyl-1-prop-2-ynylindol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(2-methyl-1,3-dioxolan-2-yl)-N-[(Z)-(2-methyl-1-prop-2-ynylindol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5427695 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-(2-methyl-1,3-dioxolan-2-yl)-N-[(Z)-(2-methyl-1-prop-2-ynylindol-3-yl)methylideneamino]acetamide |
| SMILES | C#CCn1c(C)c(/C=N\NC(=O)CC2(C)OCCO2)c2ccccc21 |
| InChI | InChI=1S/C19H21N3O3/c1-4-9-22-14(2)16(15-7-5-6-8-17(15)22)13-20-21-18(23)12-19(3)24-10-11-25-19/h1,5-8,13H,9-12H2,2-3H3,(H,21,23)/b20-13- |
| InChIKey | QYOJPOXNEQJXQP-MOSHPQCFSA-N |
| XLogP | 2.19 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|