C21H26BrN3O3 — CID 92663507
N-[(Z)-[4-bromo-1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide (PubChem CID 92663507) has the molecular formula C21H26BrN3O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is N-[(Z)-[4-bromo-1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide.
| Compound Name | N-[(Z)-[4-bromo-1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 92663507 |
| Molecular Formula | C21H26BrN3O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-[(Z)-[4-bromo-1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
| SMILES | Cc1cccc(C)c1-n1c(C)c(Br)c(/C=N\NC(=O)CC2(C)OCCO2)c1C |
| InChI | InChI=1S/C21H26BrN3O3/c1-13-7-6-8-14(2)20(13)25-15(3)17(19(22)16(25)4)12-23-24-18(26)11-21(5)27-9-10-28-21/h6-8,12H,9-11H2,1-5H3,(H,24,26)/b23-12- |
| InChIKey | MCAITWOOAZNVHW-FMCGGJTJSA-N |
| XLogP | 4.08 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|