C18H19BrN4O — CID 92663448
N-[(Z)-[4-bromo-1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-cyanoacetamide (PubChem CID 92663448) has the molecular formula C18H19BrN4O and a molecular weight of 387.28 g/mol. Its IUPAC name is N-[(Z)-[4-bromo-1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-cyanoacetamide.
| Compound Name | N-[(Z)-[4-bromo-1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 92663448 |
| Molecular Formula | C18H19BrN4O |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-[(Z)-[4-bromo-1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-cyanoacetamide |
| SMILES | Cc1ccc(-n2c(C)c(Br)c(/C=N\NC(=O)CC#N)c2C)cc1C |
| InChI | InChI=1S/C18H19BrN4O/c1-11-5-6-15(9-12(11)2)23-13(3)16(18(19)14(23)4)10-21-22-17(24)7-8-20/h5-6,9-10H,7H2,1-4H3,(H,22,24)/b21-10- |
| InChIKey | NXAQWSFFDJGVOT-FBHDLOMBSA-N |
| XLogP | 3.84 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|