C26H29BrN4O2 — CID 92663547
N-[(Z)-[4-bromo-2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-4-(morpholin-4-ylmethyl)benzamide (PubChem CID 92663547) has the molecular formula C26H29BrN4O2 and a molecular weight of 509.45 g/mol. Its IUPAC name is N-[(Z)-[4-bromo-2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-4-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[(Z)-[4-bromo-2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 92663547 |
| Molecular Formula | C26H29BrN4O2 |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | N-[(Z)-[4-bromo-2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
| SMILES | Cc1cccc(-n2c(C)c(Br)c(/C=N\NC(=O)c3ccc(CN4CCOCC4)cc3)c2C)c1 |
| InChI | InChI=1S/C26H29BrN4O2/c1-18-5-4-6-23(15-18)31-19(2)24(25(27)20(31)3)16-28-29-26(32)22-9-7-21(8-10-22)17-30-11-13-33-14-12-30/h4-10,15-16H,11-14,17H2,1-3H3,(H,29,32)/b28-16- |
| InChIKey | NZMWKMXFSWKKKA-NTFVMDSBSA-N |
| XLogP | 4.76 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|