C20H22BrN3O4 — CID 3722316
N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(morpholin-4-ylmethyl)benzamide (PubChem CID 3722316) has the molecular formula C20H22BrN3O4 and a molecular weight of 448.32 g/mol. Its IUPAC name is N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3722316 |
| Molecular Formula | C20H22BrN3O4 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(CN3CCOCC3)cc2)cc(Br)c1O |
| InChI | InChI=1S/C20H22BrN3O4/c1-27-18-11-15(10-17(21)19(18)25)12-22-23-20(26)16-4-2-14(3-5-16)13-24-6-8-28-9-7-24/h2-5,10-12,25H,6-9,13H2,1H3,(H,23,26) |
| InChIKey | AZQNAFWZJNITJP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|