C17H19N3O4 — CID 135691055
4-(aminomethyl)-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]benzamide (PubChem CID 135691055) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(aminomethyl)-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135691055 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-(aminomethyl)-N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(CN)cc2)cc(OC)c1O |
| InChI | InChI=1S/C17H19N3O4/c1-23-14-7-12(8-15(24-2)16(14)21)10-19-20-17(22)13-5-3-11(9-18)4-6-13/h3-8,10,21H,9,18H2,1-2H3,(H,20,22)/b19-10+ |
| InChIKey | JZVDGHIGPVWLNB-VXLYETTFSA-N |
| XLogP | 1.63 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|