C30H30BrN3OS — CID 98055924
4-(benzylsulfanylmethyl)-N-[(Z)-[4-bromo-1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 98055924) has the molecular formula C30H30BrN3OS and a molecular weight of 560.56 g/mol. Its IUPAC name is 4-(benzylsulfanylmethyl)-N-[(Z)-[4-bromo-1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-(benzylsulfanylmethyl)-N-[(Z)-[4-bromo-1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 98055924 |
| Molecular Formula | C30H30BrN3OS |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 4-(benzylsulfanylmethyl)-N-[(Z)-[4-bromo-1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(-n2c(C)c(Br)c(/C=N\NC(=O)c3ccc(CSCc4ccccc4)cc3)c2C)c(C)c1 |
| InChI | InChI=1S/C30H30BrN3OS/c1-20-10-15-28(21(2)16-20)34-22(3)27(29(31)23(34)4)17-32-33-30(35)26-13-11-25(12-14-26)19-36-18-24-8-6-5-7-9-24/h5-17H,18-19H2,1-4H3,(H,33,35)/b32-17- |
| InChIKey | FVKXEJBYSSAIOJ-KYHGBAKBSA-N |
| XLogP | 7.67 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|