C23H23BrClN3OS — CID 92663346
N-[(Z)-[4-bromo-2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide (PubChem CID 92663346) has the molecular formula C23H23BrClN3OS and a molecular weight of 504.88 g/mol. Its IUPAC name is N-[(Z)-[4-bromo-2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-[4-bromo-2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 92663346 |
| Molecular Formula | C23H23BrClN3OS |
| Molecular Weight | 504.88 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | N-[(Z)-[4-bromo-2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]-2-[(4-chlorophenyl)methylsulfanyl]acetamide |
| SMILES | Cc1ccccc1-n1c(C)c(Br)c(/C=N\NC(=O)CSCc2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C23H23BrClN3OS/c1-15-6-4-5-7-21(15)28-16(2)20(23(24)17(28)3)12-26-27-22(29)14-30-13-18-8-10-19(25)11-9-18/h4-12H,13-14H2,1-3H3,(H,27,29)/b26-12- |
| InChIKey | BOHISGAONPPSPS-ZRGSRPPYSA-N |
| XLogP | 6.20 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.88 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|