C28H25BrClN3OS — CID 98055886
N-[(Z)-[4-bromo-2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide (PubChem CID 98055886) has the molecular formula C28H25BrClN3OS and a molecular weight of 566.95 g/mol. Its IUPAC name is N-[(Z)-[4-bromo-2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide.
| Compound Name | N-[(Z)-[4-bromo-2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 98055886 |
| Molecular Formula | C28H25BrClN3OS |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | N-[(Z)-[4-bromo-2,5-dimethyl-1-(2-methylphenyl)pyrrol-3-yl]methylideneamino]-4-[(4-chlorophenyl)sulfanylmethyl]benzamide |
| SMILES | Cc1ccccc1-n1c(C)c(Br)c(/C=N\NC(=O)c2ccc(CSc3ccc(Cl)cc3)cc2)c1C |
| InChI | InChI=1S/C28H25BrClN3OS/c1-18-6-4-5-7-26(18)33-19(2)25(27(29)20(33)3)16-31-32-28(34)22-10-8-21(9-11-22)17-35-24-14-12-23(30)13-15-24/h4-16H,17H2,1-3H3,(H,32,34)/b31-16- |
| InChIKey | SNUKMTKGNQCRJF-ACXHZZMFSA-N |
| XLogP | 7.87 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|