C27H25N3OS — CID 92851030
N-[(Z)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4-(phenylsulfanylmethyl)benzamide (PubChem CID 92851030) has the molecular formula C27H25N3OS and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[(Z)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4-(phenylsulfanylmethyl)benzamide.
| Compound Name | N-[(Z)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4-(phenylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 92851030 |
| Molecular Formula | C27H25N3OS |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[(Z)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4-(phenylsulfanylmethyl)benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(CSc3ccccc3)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C27H25N3OS/c1-20-17-24(21(2)30(20)25-9-5-3-6-10-25)18-28-29-27(31)23-15-13-22(14-16-23)19-32-26-11-7-4-8-12-26/h3-18H,19H2,1-2H3,(H,29,31)/b28-18- |
| InChIKey | FIQCWQBSPMMRHE-VEILYXNESA-N |
| XLogP | 6.15 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|