C31H32ClN5O — CID 5094627
N-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide (PubChem CID 5094627) has the molecular formula C31H32ClN5O and a molecular weight of 526.08 g/mol. Its IUPAC name is N-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 5094627 |
| Molecular Formula | C31H32ClN5O |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | N-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[(4-phenylpiperazin-1-yl)methyl]benzamide |
| SMILES | Cc1cc(C=NNC(=O)c2ccc(CN3CCN(c4ccccc4)CC3)cc2)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C31H32ClN5O/c1-23-19-27(24(2)37(23)30-10-6-7-28(32)20-30)21-33-34-31(38)26-13-11-25(12-14-26)22-35-15-17-36(18-16-35)29-8-4-3-5-9-29/h3-14,19-21H,15-18,22H2,1-2H3,(H,34,38) |
| InChIKey | CUBLPPDMQMKMQD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|