C32H34N4O — CID 3128323
4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-N-[[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 3128323) has the molecular formula C32H34N4O and a molecular weight of 490.65 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-N-[[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-N-[[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3128323 |
| Molecular Formula | C32H34N4O |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-N-[[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(-n2c(C)cc(C=NNC(=O)c3ccc(CN4CCc5ccccc5C4)cc3)c2C)cc1C |
| InChI | InChI=1S/C32H34N4O/c1-22-9-14-31(17-23(22)2)36-24(3)18-30(25(36)4)19-33-34-32(37)28-12-10-26(11-13-28)20-35-16-15-27-7-5-6-8-29(27)21-35/h5-14,17-19H,15-16,20-21H2,1-4H3,(H,34,37) |
| InChIKey | GUHAJQSECAVRKX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|