C32H34FN5O — CID 92851150
4-[(4-benzylpiperazin-1-yl)methyl]-N-[(Z)-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 92851150) has the molecular formula C32H34FN5O and a molecular weight of 523.66 g/mol. Its IUPAC name is 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(Z)-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(Z)-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 92851150 |
| Molecular Formula | C32H34FN5O |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 4-[(4-benzylpiperazin-1-yl)methyl]-N-[(Z)-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(CN3CCN(Cc4ccccc4)CC3)cc2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C32H34FN5O/c1-24-20-29(25(2)38(24)31-11-7-6-10-30(31)33)21-34-35-32(39)28-14-12-27(13-15-28)23-37-18-16-36(17-19-37)22-26-8-4-3-5-9-26/h3-15,20-21H,16-19,22-23H2,1-2H3,(H,35,39)/b34-21- |
| InChIKey | ICLHCUMKQHKKEJ-ZXSNDDASSA-N |
| XLogP | 5.31 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|