C33H35ClN4O — CID 6176812
4-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide (PubChem CID 6176812) has the molecular formula C33H35ClN4O and a molecular weight of 539.12 g/mol. Its IUPAC name is 4-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6176812 |
| Molecular Formula | C33H35ClN4O |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | 4-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(CN3CCC(Cc4ccccc4)CC3)cc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H35ClN4O/c1-24-20-30(25(2)38(24)32-14-12-31(34)13-15-32)22-35-36-33(39)29-10-8-28(9-11-29)23-37-18-16-27(17-19-37)21-26-6-4-3-5-7-26/h3-15,20,22,27H,16-19,21,23H2,1-2H3,(H,36,39)/b35-22- |
| InChIKey | UUKYPCAJDNALCR-QHDYCIAZSA-N |
| XLogP | 6.97 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|