C30H28N4O2S — CID 40591599
4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]benzamide (PubChem CID 40591599) has the molecular formula C30H28N4O2S and a molecular weight of 508.65 g/mol. Its IUPAC name is 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]benzamide.
| Compound Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 40591599 |
| Molecular Formula | C30H28N4O2S |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 4-[(2R)-3-benzyl-4-oxo-1,3-thiazolidin-2-yl]-N-[(Z)-(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc([C@H]3SCC(=O)N3Cc3ccccc3)cc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C30H28N4O2S/c1-21-17-26(22(2)34(21)27-11-7-4-8-12-27)18-31-32-29(36)24-13-15-25(16-14-24)30-33(28(35)20-37-30)19-23-9-5-3-6-10-23/h3-18,30H,19-20H2,1-2H3,(H,32,36)/b31-18-/t30-/m1/s1 |
| InChIKey | CEUJZCSUDRULNX-WPJWDDELSA-N |
| XLogP | 5.63 |
| TPSA | 66.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|