C29H28BrN3OS — CID 98055903
N-[(Z)-[4-bromo-1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-(phenylsulfanylmethyl)benzamide (PubChem CID 98055903) has the molecular formula C29H28BrN3OS and a molecular weight of 546.53 g/mol. Its IUPAC name is N-[(Z)-[4-bromo-1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-(phenylsulfanylmethyl)benzamide.
| Compound Name | N-[(Z)-[4-bromo-1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-(phenylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 98055903 |
| Molecular Formula | C29H28BrN3OS |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | N-[(Z)-[4-bromo-1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-(phenylsulfanylmethyl)benzamide |
| SMILES | Cc1ccc(-n2c(C)c(Br)c(/C=N\NC(=O)c3ccc(CSc4ccccc4)cc3)c2C)c(C)c1 |
| InChI | InChI=1S/C29H28BrN3OS/c1-19-10-15-27(20(2)16-19)33-21(3)26(28(30)22(33)4)17-31-32-29(34)24-13-11-23(12-14-24)18-35-25-8-6-5-7-9-25/h5-17H,18H2,1-4H3,(H,32,34)/b31-17- |
| InChIKey | WBGLOUGGKAUJTN-LJUMEUDFSA-N |
| XLogP | 7.53 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|