C24H30N4O2 — CID 145127992
N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 145127992) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 145127992 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | O=C(N/N=C/c1ccc(N2CCOCC2)cc1)c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C24H30N4O2/c29-24(22-8-4-21(5-9-22)19-27-12-2-1-3-13-27)26-25-18-20-6-10-23(11-7-20)28-14-16-30-17-15-28/h4-11,18H,1-3,12-17,19H2,(H,26,29)/b25-18+ |
| InChIKey | VGTFKWXEQOJRDL-XIEYBQDHSA-N |
| XLogP | 3.27 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|